
CAS Number32017-76-8
Synonyms(±)-2-(4-bromophenyl)oxirane; Oxirane,(4-bromophenyl); 1-Bromo-4-(epoxyethyl)benzene; Oxirane,(p-bromophenyl); 4-Br-styrene oxide; MFCD01656787; 4-Bromostyrene oxide; (4-Bromophenyl)oxirane; p-Bromostyrene 7,8-oxide; p-bromostyrene oxide; 2-(4-Bromophenyl)oxirane
Molecular FormulaC8H7BrO
Molecular Weight199.05
Purity96+%
Density1.596g/cm3
Boiling Point91-93ºC2 mm Hg(lit.)
Melting Point26-29ºC(lit.)
AppearanceLow Melting Mass or Crystals | White to yellow
EINECS0
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32017-76-8 |
| Catalog No. | 2A-0115277 |
| Chinese Name | 2-(4-溴苯基)环氧乙烷 |
| Synonyms | (±)-2-(4-bromophenyl)oxirane; Oxirane,(4-bromophenyl); 1-Bromo-4-(epoxyethyl)benzene; Oxirane,(p-bromophenyl); 4-Br-styrene oxide; MFCD01656787; 4-Bromostyrene oxide; (4-Bromophenyl)oxirane; p-Bromostyrene 7,8-oxide; p-bromostyrene oxide; 2-(4-Bromophenyl)oxirane |
| Molecular Formula | C8H7BrO |
| Molecular Weight | 199.05 |
| Purity | 96+ |
| Density | 1.596g/cm3 |
| Boiling Point | 91-93ºC2 mm Hg(lit.) |
| Melting Point | 26-29ºC(lit.) |
| Appearance | Low Melting Mass or Crystals | White to yellow |
| Water Solubility | Insoluble in water. |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| EINECS | 0 |
| HTC | 2910900090 |
| UN(IATA) | 0 |
| PubChem ID | 4984579 |
| SMILES | Brc1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C8H7BrO/c9-7-3-1-6(2-4-7)8-5-10-8/h1-4,8H,5H2 |
| InChI Key | NNINSLOEPXEZOZ-UHFFFAOYSA-N |
| Hazard Symbols | 4.1 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(4-BROMOPHENYL)-4,7-DICHLOROQUINAZOLINE | 405933-94-0 | 2A-0115253 |
| 2-(4-BROMOPHENYL)-4-CHLORO-6-FLUOROQUINAZOLINE | 881310-87-8 | 2A-0115255 |
| 2-(4-BROMOPHENYL)-4-CHLORO-6-METHYLQUINAZOLINE | 405933-97-3 | 2A-0115256 |
| 2-(4-BROMOPHENYL)-4-CHLORO-7-FLUOROQUINAZOLINE | 885277-86-1 | 2A-0115257 |
| 2-(4-BROMOPHENYL)-5-(PROP-1-EN-2-YL)-1,3,4-OXADIAZOLE | 1033201-91-0 | 2A-0115259 |
| 2-(4-CHLOROPHENYL)-3-METHYLQUINOLINE-4-CARBOXYLIC ACID | 43071-47-2 | 2A-0115364 |
| 2-(4-CHLOROPHENYL)-5-(PIPERIDIN-4-YL)-1,3,4-OXADIAZOLE | 751473-46-8 | 2A-0115370 |
| 2-(4-CHLOROPHENYL)-8-METHYLQUINOLINE-4-CARBOXYLIC ACID | 107027-43-0 | 2A-0115374 |
| 2-(4-CHLOROPHENYL)THIAZOLE-5-CARBOXYLIC ACID | 205692-14-4 | 2A-0115396 |
| 2-(4-DIMETHYLAMINOPHENYL)-1,3-THIAZOLE-4-CARBOXYLIC ACID | 955400-50-7 | 2A-0115414 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA