
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32019-08-2 |
| Catalog No. | 2A-0115230 |
| Chinese Name | 2-(4-溴苯氧基)丙酸 |
| Synonyms | 4-Brom-phenylaethermilchsaeure; 2-(4-Bromophenoxy)propanoic acid |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 340.0±17.0 °C at 760 mmHg |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| PubChem ID | 4722764 |
| SMILES | CC(Oc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C9H9BrO3/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12) |
| InChI Key | IWXNSVLXICBLHY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)ACETIC ACID | 312309-43-6 | 2A-0115206 |
| 2-(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)ACETONITRILE | 175137-59-4 | 2A-0115208 |
| 2-(4-BROMO-3,5-DIMETHYL-1H-PYRAZOL-1-YL)ETHANETHIOAMIDE | 175202-68-3 | 2A-0115209 |
| 2-(4-BROMOBENZOYL)BENZOIC ACID | 2159-40-2 | 2A-0115217 |
| 2-(4-BROMOPHENOXY)ACETAMIDE | 35368-75-3 | 2A-0115226 |
| 2-(4-BROMOPHENOXY)TETRAHYDRO-2H-PYRAN | 36603-49-3 | 2A-0115232 |
| 2-(4-BROMOPHENYL)-1-(2-HYDROXY-4-METHOXYPHENYL)ETHANONE | 170014-23-0 | 2A-0115238 |
| 2-(4-BROMOPHENYL)-1-(4-METHYLPIPERAZIN-1-YL)ETHANONE | 349430-56-4 | 2A-0115239 |
| 2-(4-BROMOPHENYL)-1-(MORPHOLIN-4-YL)ETHANONE | 349428-85-9 | 2A-0115240 |
| 2-(4-BROMOPHENYL)-2,3-DIHYDRO-4(1H)-QUINOLINONE | 130820-63-2 | 2A-0115243 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA