
CAS Number195447-79-1
SynonymsQV1R CF EXFFF; 3-Fluoro-5-(trifluoromethyl)benzeneacetic acid; 2-(3-Fluoro-5-(trifluoromethyl)phenyl)acetic acid; MFCD00061187; 2-Fluoro-5-(trifluoromethyl)phenylacetic acid; 2-[5-Fluoro-3-(trifluoromethyl)phenyl]acetic acid; 3-Fluoro-5-(trifluoromethyl)phenylacetic acid; [3-Fluoro-5-(trifluoromethyl)phenyl]acetic acid
Molecular FormulaC9H6F4O2
Molecular Weight222.136
Purity96+%
Density1.4±0.1 g/cm3
Boiling Point242.1±35.0 °C at 760 mmHg
Melting Point109-112℃
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 195447-79-1 |
| Catalog No. | 2A-0114697 |
| Chinese Name | 3-氟-5-(三氟甲基)苯醋酸 |
| Synonyms | QV1R CF EXFFF; 3-Fluoro-5-(trifluoromethyl)benzeneacetic acid; 2-(3-Fluoro-5-(trifluoromethyl)phenyl)acetic acid; MFCD00061187; 2-Fluoro-5-(trifluoromethyl)phenylacetic acid; 2-[5-Fluoro-3-(trifluoromethyl)phenyl]acetic acid; 3-Fluoro-5-(trifluoromethyl)phenylacetic acid; [3-Fluoro-5-(trifluoromethyl)phenyl]acetic acid |
| Molecular Formula | C9H6F4O2 |
| Molecular Weight | 222.136 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 242.1±35.0 °C at 760 mmHg |
| Melting Point | 109-112℃ |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| EINECS | 0 |
| HTC | 2916399090 |
| UN(IATA) | 0 |
| SMILES | O=C(O)Cc1cc(F)cc(C(F)(F)F)c1 |
| InChI Key | LQIBHDUPSIQRPV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(3-CHLOROTHIOPHEN-2-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 1040281-97-7 | 2A-0114668 |
| 2-(3-CYCLOPENTYLPROP-1-EN-1-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 1073354-57-0 | 2A-0114674 |
| 2-(3-ETHOXY-5-METHYLPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 1218789-71-9 | 2A-0114678 |
| 2-(3-FLUORO-4-(TRIFLUOROMETHYL)PHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 445303-67-3 | 2A-0114686 |
| 2-(3-FLUORO-4-METHYLPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 903895-56-7 | 2A-0114693 |
| 2-(3-ISOBUTOXY-5-METHYLPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 1218789-78-6 | 2A-0114738 |
| 2-(3-ISOPROPOXY-5-METHYLPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 1218789-75-3 | 2A-0114739 |
| 2-(3-ISOPROPOXYPHENYL)-2-OXOACETALDEHYDE HYDRATE | 1189863-58-8 | 2A-0114740 |
| 2-(3-ISOPROPYLPHENYL)-1,3,2-DIOXABOROLANE | 374537-96-9 | 2A-0114742 |
| 2-(3-ISOPROPYLPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | 325142-89-0 | 2A-0114743 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA