
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 331-40-8 |
| Catalog No. | 2A-0114599 |
| Chinese Name | 2-(3-氯-4-氟苯氧基)乙酸 |
| Synonyms | 3-chloro-4-fluoro-phenoxyacetic acid |
| Molecular Formula | C8H6ClFO3 |
| Molecular Weight | 204.58 |
| Purity | 96+ |
| Density | 1.453g/cm3 |
| Boiling Point | 334ºC at 760mmHg |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| SMILES | O=C(O)COc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C8H6ClFO3/c9-6-3-5(1-2-7(6)10)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
| InChI Key | JHDKSQRVPAURMA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(3-BROMOQUINOLIN-6-YL)ACETIC ACID | 1022091-93-5 | 2A-1114584 |
| 2-(3-BUTYRYL-1H-INDOL-1-YL)ACETIC ACID | 892676-98-1 | 2A-0114587 |
| 2-(3-CHLORO-2-METHYLPHENYL)ACETIC ACID | 14161-84-3 | 2A-0114591 |
| 2-(3-CHLORO-2-OXOINDOLIN-4-YL)ETHYL BENZOATE | 139122-17-1 | 2A-0114593 |
| 2-(3-CHLORO-4-FLUOROPHENOXY)-4-METHYLANILINE | 946774-33-0 | 2A-0114598 |
| 2-(3-CHLORO-4-METHOXYPHENYL)ACETIC ACID | 13721-20-5 | 2A-0114601 |
| 2-(3-CHLOROBENZAMIDO)ACETIC ACID | 57728-59-3 | 2A-0114625 |
| 2-(3-CHLOROPHENYL)ACETAMIDE | 58357-84-9 | 2A-0114646 |
| 2-(3-CHLOROPHENYL)ETHANAMINE HYDROCHLORIDE | 89042-13-7 | 2A-0114649 |
| 2-(3-CHLOROPYRAZIN-2-YL)ACETONITRILE | 914360-88-6 | 2A-0114663 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA