![2-(3'-ETHOXY-[1,1'-BIPHENYL]-3-YL)ACETIC ACID structure, CAS 558641-22-8](/structures/120000/114283_1_558641_22_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 558641-22-8 |
| Catalog No. | 2A-0114283 |
| Chinese Name | 3-联苯-(3-乙氧基)乙酸 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.296 |
| Purity | 96+ |
| Density | 1.151g/cm3 |
| Boiling Point | 422.3ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2922299090 |
| UN(IATA) | 0 |
| SMILES | CCOc1cccc(-c2cccc(CC(=O)O)c2)c1 |
| InChI Key | PQVWNDCXWUXZNC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(3',5'-DICHLORO-[1,1'-BIPHENYL]-3-YL)ACETIC ACID | 669713-80-8 | 2A-0114278 |
| 2-(3',5'-DICHLORO-[1,1'-BIPHENYL]-4-YL)ACETIC ACID | 669713-81-9 | 2A-0114279 |
| 2-(3',5'-DIFLUORO-[1,1'-BIPHENYL]-4-YL)ACETIC ACID | 886363-26-4 | 2A-0114280 |
| 2-(3'-CHLORO-5'-FLUORO-[1,1'-BIPHENYL]-4-YL)ACETIC ACID | 1334499-97-6 | 2A-0114281 |
| 2-(3'-ETHOXY-[1,1'-BIPHENYL]-2-YL)ACETIC ACID | 669713-68-2 | 2A-0114282 |
| 2-(3'-ETHOXY-[1,1'-BIPHENYL]-4-YL)ACETIC ACID | 669713-69-3 | 2A-0114284 |
| 2-(3'-FLUORO-[1,1'-BIPHENYL]-4-YL)PROPANOIC ACID | 17692-38-5 | 2A-0114288 |
| 2-(3'-METHOXY-[1,1'-BIPHENYL]-2-YL)ACETIC ACID | 108478-56-4 | 2A-0114289 |
| 2-(3'-METHOXY-[1,1'-BIPHENYL]-3-YL)ACETIC ACID | 669713-72-8 | 2A-0114290 |
| 2-(3'-METHOXY-[1,1'-BIPHENYL]-4-YL)ACETIC ACID | 669713-73-9 | 2A-0114291 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA