
CAS Number1879-56-7
Synonymso-Bromophenoxyacetic acid; 2-bromo phenoxyacetic acid; (2-Brom-phenoxy)-essigsaeure; Acetic acid,(2-bromophenoxy); O-(2-Brom-phenyl)-glykolsaeure; MFCD00234407; (2-Bromophenoxy)acetic acid; 2-Bromophenoxyacetic acid; 2-Brom-phenylaetherglykolsaeure
Molecular FormulaC8H7O3Br1
Molecular Weight231.05
Purity96+%
Density1.6±0.1 g/cm3
Boiling Point330.8±17.0 °C at 760 mmHg
Melting Point141-145 °C
AppearanceWhite to light pink crystalline powder
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1879-56-7 |
| Catalog No. | 2A-1113938 |
| Chinese Name | 邻溴苯氧基乙酸 |
| Synonyms | o-Bromophenoxyacetic acid; 2-bromo phenoxyacetic acid; (2-Brom-phenoxy)-essigsaeure; Acetic acid,(2-bromophenoxy); O-(2-Brom-phenyl)-glykolsaeure; MFCD00234407; (2-Bromophenoxy)acetic acid; 2-Bromophenoxyacetic acid; 2-Brom-phenylaetherglykolsaeure |
| Molecular Formula | C8H7O3Br1 |
| Molecular Weight | 231.05 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 330.8±17.0 °C at 760 mmHg |
| Melting Point | 141-145 °C |
| Appearance | White to light pink crystalline powder |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00234407 |
| SMILES | O=C(O)COc1ccccc1Br |
| InChI | InChI=1S/C8H7BrO3/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| InChI Key | AZYODYPUWJPKOI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-AMINOPYRIDIN-3-YL)ACETIC ACID | 101860-97-3 | 2A-0113904 |
| 2-(2-AMINOTHIAZOL-4-YL)-2-(HYDROXYIMINO)ACETIC ACID | 120570-48-1 | 2A-0113907 |
| 2-(2-BORONOPHENYL)ACETIC ACID | 1001108-64-0 | 2A-0113919 |
| 2-(2-BROMO-4-FLUOROPHENYL)ACETONITRILE | 61150-58-1 | 2A-0113924 |
| 2-(2-BROMOETHYL)NAPHTHALENE | 2086-62-6 | 2A-0113936 |
| 2-(2-BROMOPHENOXY)PROPANOIC ACID | 7414-41-7 | 2A-0113940 |
| 2-(2-BROMOPHENYL)-2-(DIMETHYLAMINO)ACETONITRILE | 299215-38-6 | 2A-0113944 |
| 2-(2-BROMOPHENYL)ACETAMIDE | 65999-53-3 | 2A-0113948 |
| 2-(2-BROMOPHENYL)ISOTHIAZOLIDINE 1,1-DIOXIDE | 71703-14-5 | 2A-0113950 |
| 2-(2-BROMOPHENYL)PROPAN-2-OL | 7073-69-0 | 2A-0113952 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA