
CAS Number18903-01-0
SynonymsMFCD00063251; trans-1-cinnamyl piperazine; EINECS 242-652-0; 1-cinnamyl-piperazine; N-CINNAMYLPIPERAZINE; 1-TRANS-CINNAMYL PIPERAZINE; trans-1-Ciamylpiperazine
Molecular FormulaC13H18N2
Molecular Weight202.29500
Purity98%
Density0.989g/mLat25ºC(lit.)
Boiling Point129ºC1 mm Hg(lit.)
Melting Point39-44ºC(lit.)
AppearanceClear colorless to yellow liquid after melting point
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18903-01-0 |
| Catalog No. | 2A-9001137 |
| Chinese Name | N-肉桂基哌嗪 |
| Synonyms | MFCD00063251; trans-1-cinnamyl piperazine; EINECS 242-652-0; 1-cinnamyl-piperazine; N-CINNAMYLPIPERAZINE; 1-TRANS-CINNAMYL PIPERAZINE; trans-1-Ciamylpiperazine |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.29500 |
| Purity | 98 |
| Density | 0.989g/mLat25ºC(lit.) |
| Boiling Point | 129ºC1 mm Hg(lit.) |
| Melting Point | 39-44ºC(lit.) |
| Appearance | Clear colorless to yellow liquid after melting point |
| HTC | 2933599090 |
| SMILES | C1C[NH+](CC[NH2+]1)C\C=C\c2ccccc2 |
| InChI | InChI=1S/C13H18N2/c1-2-5-13(6-3-1)7-4-10-15-11-8-14-9-12-15/h1-7,14H,8-12H2/p+2/b7-4+ |
| InChI Key | InChIKey=WGEIOMTZIIOUMA-QPJJXVBHSA-P |
| MSDS | msds/1137_1_18903_01_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Benzyl Piperazine HCL | 72878-35-4 | 2A-9000991 |
| 1-Benzylpiperidine-4-carboxylic acid ethyl ester | 24228-40-8 | 2A-9000992 |
| 1-Bromoisoquinoline | 1532-71-4 | 2A-9001083 |
| 1-Chloropropyl-4-methylpiperazine | 916791-76-9 | 2A-9001135 |
| 1-Cinnamoylpiperazine | 55486-27-6 | 2A-9001136 |
| 1-Cyanoisoquinoline | 1198-30-7 | 2A-9001138 |
| 1-Cyclohexyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid | 135906-00-2 | 2A-9001139 |
| 1-Cyclohexyl-5-(4-chlorobutyl)-1H-tetrazole | 73963-42-5 | 2A-9001140 |
| 1-Cyclooctylpiperazine | 21043-43-6 | 2A-9001142 |
| 1-Cyclopentylpiperazine | 21043-40-3 | 2A-9001143 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA