CAS Number70630-17-0
Synonymsmethyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate; Metalaxyl-M; Metalaxil; methyl N-(methoxyacetyl)-N-2,6-xylyl-D-alaninate; methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-D-alaninate; Methenoxam; (-)-Metalaxyl; R-metalaxyl; (-)-(R)-metalaxyl; MFCD03701742; Methyl N-(methoxyacetyl)-N-(2,6-xylyl)-D-alaninate; [(R)-N-(2,6-dimethylphenyl)-N-(methoxyacetylamino)propionic acid methyl ester]; Subdue Maxx; mefenoxam; Ridomil Gold; (R)-2-[(2,6-dimethylphenyl)methoxyacetylamino]propionic acid methyl ester; Metalaxyl-M [ISO:BSI]
Molecular FormulaC15H21NO4
Molecular Weight279.33
Purity98.00%
Density1.117 g/cm3
Boiling Point394.3ºC at 760 mmHg
Melting Point38.7ºC
AppearanceLight yellow to light brown thick liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70630-17-0 |
| Catalog No. | 2A-9011317 |
| Chinese Name | 精甲霜灵 |
| Synonyms | methyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate; Metalaxyl-M; Metalaxil; methyl N-(methoxyacetyl)-N-2,6-xylyl-D-alaninate; methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-D-alaninate; Methenoxam; (-)-Metalaxyl; R-metalaxyl; (-)-(R)-metalaxyl; MFCD03701742; Methyl N-(methoxyacetyl)-N-(2,6-xylyl)-D-alaninate; [(R)-N-(2,6-dimethylphenyl)-N-(methoxyacetylamino)propionic acid methyl ester]; Subdue Maxx; mefenoxam; Ridomil Gold; (R)-2-[(2,6-dimethylphenyl)methoxyacetylamino]propionic acid methyl ester; Metalaxyl-M [ISO:BSI] |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.33 |
| Purity | 98.00 |
| Density | 1.117 g/cm3 |
| Boiling Point | 394.3ºC at 760 mmHg |
| Melting Point | 38.7ºC |
| Appearance | Light yellow to light brown thick liquid |
| Storage Condition | 0-6°C |
| Application | Metalaxyl-M ((R)-Metalaxyl) is the R-enantiomer of methoxy. Metalaxyl-M is a broad-spectrum fungicide agent that inhibits protein and ribosomal RNA synthesis in fungi. Metalaxyl is used to study plant |
| PubChem ID | 329754334 |
| MDL Number | MFCD03701742 |
| SMILES | COCC(=O)N([C@H](C)C(=O)OC)c1c(C)cccc1C |
| InChI | 1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m1/s1 |
| InChI Key | ZQEIXNIJLIKNTD-GFCCVEGCSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/11317_1_70630_17_0.pdf |
| Transport Info | Product name: Jingjiaxingling |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Lactofen | 77501-63-4 | 2A-9011113 |
| Lambda-cyhalothrin | 91465-08-6 | 2A-9011117 |
| Malathion | 121-75-5 | 2A-9011278 |
| Mancozeb | 2234-56-2 | 2A-0201744 |
| Mancozeb | 8018-01-7 | 2A-9011282 |
| Mepiquat Chloride | 24307-26-4 | 2A-9011338 |
| Mesotrione | 104206-82-8 | 2A-9011355 |
| Metalaxyl | 57837-19-1 | 2A-9011362 |
| Methidathion | 950-37-8 | 2A-9011376 |
| Methoprene | 40596-69-8 | 2A-9011381 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS