
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83763-47-7 |
| Catalog No. | 2A-0112862 |
| Chinese Name | 2-氨基-4-羟乙氨基茴香醚 |
| Synonyms | 2-(3-amino-4-methoxyanilino)ethanol |
| Molecular Formula | C11H17O3N1 |
| Molecular Weight | 211.26 |
| Purity | 96+ |
| Density | 1.221g/cm3 |
| Boiling Point | 401.8ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| MDL Number | MFCD09253802 |
| SMILES | COc1ccc(NCCO)cc1N |
| InChI | InChI=1S/C9H14N2O2/c1-13-9-3-2-7(6-8(9)10)11-4-5-12/h2-3,6,11-12H,4-5,10H2,1H3 |
| InChI Key | SBUMIGFDXJIPLE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-((2-(PYRIDIN-4-YL)ETHYL)THIO)ETHANOL | 78092-91-8 | 2A-0112781 |
| 2-((2-CHLORO-7-METHYL-7H-PURIN-6-YL)AMINO)ETHANOL | 100376-77-0 | 2A-0112810 |
| 2-((2-CHLOROQUINAZOLIN-4-YL)AMINO)ETHANOL | 134517-34-3 | 2A-0112815 |
| 2-((2-FLUOROBENZYL)AMINO)ETHANOL | 64834-60-2 | 2A-0112819 |
| 2-((3,4-DIMETHOXYBENZYL)AMINO)-1-PHENYLETHANOL | 110339-51-0 | 2A-0112841 |
| 2-((4-AMINO-3-METHYLPHENYL)(ETHYL)AMINO)ETHANOL | 2359-51-5 | 2A-0112915 |
| 2-((4-AMINOPHENYL)(ETHYL)AMINO)ETHANOL | 92-65-9 | 2A-0112923 |
| 2-((4-CHLOROPHENYL)THIO)ETHANOL | 13457-98-2 | 2A-0112944 |
| 2-((4-METHOXYPHENYL)(METHYL)AMINO)ETHANOL | 53332-62-0 | 2A-0112959 |
| 2-((5-BROMO-3-NITROPYRIDIN-2-YL)AMINO)ETHANOL | 1033202-32-2 | 2A-0112985 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA