
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 99610-72-7 |
| Catalog No. | 2A-0112825 |
| Chinese Name | 2-羟乙基苦氨酸 |
| Synonyms | 2-(2-hydroxyethylamino)-4,6-dinitrophenol |
| Molecular Formula | C8H9N3O6 |
| Molecular Weight | 243.174 |
| Purity | 96+ |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| SMILES | O=[N+]([O-])c1cc(NCCO)c(O)c([N+](=O)[O-])c1 |
| InChI Key | OABRBVCUJIJMOB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-((2-CARBOXYPHENYL)AMINO)-3-METHOXYBENZOIC ACID | 88377-32-6 | 2A-0112803 |
| 2-((2-CHLOROBENZYL)OXY)-6-METHOXYBENZONITRILE | 175204-02-1 | 2A-0112812 |
| 2-((2-CHLOROBENZYL)OXY)ETHANAMINE | 6594-66-7 | 2A-0112813 |
| 2-((2-CHLOROPHENYL)AMINO)ACETIC ACID | 6961-49-5 | 2A-0112814 |
| 2-((2-HYDROXYETHOXY)CARBONYL)BENZOIC ACID | 17689-42-8 | 2A-0112822 |
| 2-((2-HYDROXYETHYL)AMINO)NICOTINONITRILE | 440102-32-9 | 2A-0112827 |
| 2-((2-METHOXYPHENYL)AMINO)BENZOIC ACID | 13278-32-5 | 2A-0112828 |
| 2-((2-METHYLBENZYL)OXY)BENZOIC ACID | 743440-26-8 | 2A-0112832 |
| 2-((3,4-DIMETHYLPHENYL)AMINO)-2-OXOACETIC ACID | 665053-88-3 | 2A-0112843 |
| 2-((3,5-DIMETHOXYPHENYL)ETHYNYL)PHENOL | 1310802-16-4 | 2A-0112846 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA