
CAS Number269410-25-5
Synonyms2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol; 3,5-dimethyl-4-hydroxybenzeneboronic acid,pinacol ester; 4-Hydroxy-3,5-dimethylphenylboronic Acid Pinacol Ester; 4-Hydroxy-3,5-dimethylphenylboronic acid,pinacol cyclic ester; 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-xylenol; MFCD02093724; 2-(4-Hydroxy-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane; 2,6-dimethyl-4-(4,4-5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol; 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)-phenol; 2,5-DIMETHOXY-4-METHYL-BETA-NITROSTYRENE,>; 3,5-Dimethyl-4-hydroxyphenylboronic acid pinacol ester
Molecular FormulaC14H21BO3
Molecular Weight248.13
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point367.3±42.0 °C at 760 mmHg
Melting Point100-105 °C(lit.)
AppearanceWhite to beige crystalline powder
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 269410-25-5 |
| Catalog No. | 2A-0112537 |
| Chinese Name | 2,6-二甲基-4-(4,4,5,5-四甲基-1,3,2-二氧硼戊环-2-基)苯酚 |
| Synonyms | 2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol; 3,5-dimethyl-4-hydroxybenzeneboronic acid,pinacol ester; 4-Hydroxy-3,5-dimethylphenylboronic Acid Pinacol Ester; 4-Hydroxy-3,5-dimethylphenylboronic acid,pinacol cyclic ester; 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-xylenol; MFCD02093724; 2-(4-Hydroxy-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane; 2,6-dimethyl-4-(4,4-5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol; 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)-phenol; 2,5-DIMETHOXY-4-METHYL-BETA-NITROSTYRENE,>; 3,5-Dimethyl-4-hydroxyphenylboronic acid pinacol ester |
| Molecular Formula | C14H21BO3 |
| Molecular Weight | 248.13 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 367.3±42.0 °C at 760 mmHg |
| Melting Point | 100-105 °C(lit.) |
| Appearance | White to beige crystalline powder |
| Water Solubility | Water solubility: insoluble; soluble in: methanol |
| Storage Condition | Storage method: sealed, dry below 4 °C |
| EINECS | 0 |
| HTC | 0 |
| UN(IATA) | 0 |
| PubChem ID | 24874047 |
| MDL Number | MFCD02093724 |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1O |
| InChI | InChI=1S/C14H21BO3/c1-9-7-11(8-10(2)12(9)16)15-17-13(3,4)14(5,6)18-15/h7-8,16H,1-6H3 |
| InChI Key | TYCKOBOJYNRIBO-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352103 |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,6-DICHLORO-4-METHYLBENZALDEHYDE | 116070-31-6 | 2A-0112349 |
| 2,6-DICHLORO-4-METHYLNICOTINALDEHYDE | 91591-70-7 | 2A-0112351 |
| 2,6-DIFLUORO-3-HYDROXYBENZALDEHYDE | 152434-88-3 | 2A-0112429 |
| 2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOIC ACID | 1008119-07-0 | 2A-0112439 |
| 2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE | 1004761-68-5 | 2A-0112536 |
| 2,6-DIMETHYLQUINOLINE-4-CARBOHYDRAZIDE | 613656-68-1 | 2A-0112593 |
| 2,6-DIOXASPIRO[3.3]HEPTANE | 174-79-8 | 2A-0112599 |
| 2,7-DI-TERT-BUTYL-9,9-DIMETHYL-9H-XANTHENE-4,5-DICARBOXYLIC ACID | 130525-39-2 | 2A-0112607 |
| 2,7-DIAZASPIRO[4.5]DECANE | 40865-50-7 | 2A-1112616 |
| 2,8-DIAZASPIRO[4.5]DECAN-1-ONE HYDROCHLORIDE | 832710-65-3 | 2A-0112657 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA