
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7311-70-8 |
| Catalog No. | 2A-0111985 |
| Chinese Name | 2,5-二溴-3-噻吩甲酸 |
| Synonyms | 2,5-dibromothiophene-3-carboxylic acid |
| Molecular Formula | C5H2Br2O2S |
| Molecular Weight | 285.94 |
| Purity | 96+ |
| Density | 2.309g/cm3 |
| Boiling Point | 345.7ºC at 760 mmHg |
| Melting Point | 177.0 to 181.0 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Slightly soluble: methanol |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2934999090 |
| UN(IATA) | 0 |
| SMILES | OC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C5H2Br2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9) |
| InChI Key | InChIKey=PZBUYFPAASJYSI-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,5-DIBROMO-3-CHLOROPYRIDINE | 160599-70-2 | 2A-0111933 |
| 2,5-DIBROMO-4-FLUOROPYRIDINE | 1033203-46-1 | 2A-0111946 |
| 2,5-DIBROMO-4-METHYLPYRIMIDINE | 171408-73-4 | 2A-0111951 |
| 2,5-DIBROMO-4-NITRO-1H-IMIDAZOLE | 6154-30-9 | 2A-0111953 |
| 2,5-DIBROMOFURAN-3-CARBOXYLIC ACID | 32460-22-3 | 2A-0111963 |
| 2,5-DICHLORO-1H-INDOLE-3-CARBOXALDEHYDE | 535924-87-9 | 2A-0111990 |
| 2,5-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE | 1073371-98-8 | 2A-0111992 |
| 2,5-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE | 70158-59-7 | 2A-0111993 |
| 2,5-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE | 1073353-98-6 | 2A-0112002 |
| 2,5-DICHLORO-4-(TRIFLUOROMETHYL)PYRIMIDINE | 785777-98-2 | 2A-0112003 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA