
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 618-85-9 |
| Catalog No. | 2A-0109245 |
| Chinese Name | 3,5-二硝基甲苯 |
| Synonyms | 1-methyl-3,5-dinitrobenzene |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.826 |
| Purity | 96+ |
| Density | 1.407g/cm3 |
| Boiling Point | 307.5ºC at 760 mmHg |
| Melting Point | 93ºC |
| EINECS | 0 |
| HTC | 2904203000 |
| UN(IATA) | 0 |
| MDL Number | MFCD00223984 |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N2O4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3 |
| InChI Key | RUIFULUFLANOCI-UHFFFAOYSA-N |
| MSDS | msds/109245_1_618_85_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | M.Inspection of imported goods N.Inspection of exported goods |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-METHYL-1H-INDOL-5-OL | 13523-92-7 | 2A-0109151 |
| 1-METHYL-2-NITRO-4-(PERFLUOROETHYL)BENZENE | 134302-31-1 | 2A-0109219 |
| 1-METHYL-3,4-DIHYDRO-1H-BENZO[B]AZEPIN-5(2H)-ONE | 3749-11-9 | 2A-0109240 |
| 1-METHYL-3,4-DIHYDRO-1H-BENZO[B]AZEPIN-5(2H)-ONE HYDROCHLORIDE | 109099-47-0 | 2A-0109241 |
| 1-METHYL-3,4-DIHYDRO-1H-QUINOLIN-2-ONE | 826-72-2 | 2A-0109242 |
| 1-METHYL-3-(PIPERIDIN-4-YL)-1H-BENZO[D]IMIDAZOL-2(3H)-ONE HYDROCHLORIDE | 2147-85-5 | 2A-0109253 |
| 1-METHYL-3-(PYRIDIN-2-YL)-1H-PYRAZOL-5-AMINE | 92406-50-3 | 2A-0109254 |
| 1-METHYL-3-(PYRIDIN-3-YL)-1H-PYRAZOL-5-AMINE | 287494-25-1 | 2A-0109255 |
| 1-METHYL-3-(PYRIDIN-4-YL)-1H-PYRAZOL-5-AMINE | 38965-47-8 | 2A-0109256 |
| 1-METHYL-3-METHYLENEPIPERIDIN-2-ONE | 1690-73-9 | 2A-0109273 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA