
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41252-95-3 |
| Catalog No. | 2A-0108576 |
| Chinese Name | 2-氯-5-碘硝基苯 |
| Synonyms | 2-Chloro-5-iodonitrobenzene; 1-Chlor-4-iod-2-nitro-benzol; 1-Chlor-4-jod-2-nitro-benzol; 1-chloro-4-iodo-2-nitro-benzene; 2-Chlor-5-iod-nitrobenzol |
| Molecular Formula | C6H3ClINO2 |
| Molecular Weight | 279.03 |
| Purity | 96+ |
| Density | 2.094 |
| Appearance | solid |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| EINECS | 0 |
| HTC | 2904909090 |
| UN(IATA) | 0 |
| PubChem ID | 329772939 |
| MDL Number | MFCD01320682 |
| SMILES | COc1ccc(c(I)c1)[N+]([O-])=O |
| InChI | 1S/C7H6INO3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| InChI Key | NLTAHTYBZZSCIT-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/108576_1_41252_95_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-CHLORO-3-METHOXY-5-METHYLBENZENE | 82477-66-5 | 2A-0108543 |
| 1-CHLORO-4-((2-CHLOROETHYL)SULFONYL)BENZENE | 16191-84-7 | 2A-0108552 |
| 1-CHLORO-4-(FLUOROMETHYL)BENZENE | 352-12-5 | 2A-0108564 |
| 1-CHLORO-4-FLUORO-2-METHYL-5-NITROBENZENE | 170098-88-1 | 2A-0108569 |
| 1-CHLORO-4-IODO-2,5-DIMETHOXYBENZENE | 90064-46-3 | 2A-0108574 |
| 1-CHLORO-4-NITRO-2-PROPOXYBENZENE | 76464-50-1 | 2A-0108581 |
| 1-CHLORO-6,6-DIMETHYL-3-(METHYLTHIO)-6,7-DIHYDROBENZO[C]THIOPHEN-4(5H)-ONE | 175202-90-1 | 2A-0108590 |
| 1-CYANATO-2-METHOXYBENZENE | 1125-91-3 | 2A-0108618 |
| 1-CYCLOBUTYLPIPERIDIN-4-ONE HYDROCHLORIDE | 1210824-86-4 | 2A-0108629 |
| 1-CYCLOHEPTYLGUANIDINE | 847572-30-9 | 2A-0108631 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA