
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14233-28-4 |
| Catalog No. | 2A-0108332 |
| Chinese Name | 1-环己基氨基-4-溴蒽醌 |
| Synonyms | 1-cyclohexylamino-4-bromo-anthraquinone; 4-bromo-1-cyclohexylaminoanthraquinone; 1-Cyclohexylamino-4-bromoanthrqaquinone |
| Molecular Formula | C20H18BrNO2 |
| Molecular Weight | 384.26600 |
| Purity | 96+ |
| Density | 1.493g/cm3 |
| Boiling Point | 567.6ºC at 760mmHg |
| EINECS | 0 |
| HTC | 2922399090 |
| UN(IATA) | 0 |
| SMILES | O=C1c2ccccc2C(=O)c2c(NC3CCCCC3)ccc(Br)c21 |
| InChI Key | WIMJTAGMOPIYOA-UHFFFAOYSA-N |
| MSDS | msds/108332_1_14233_28_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-BROMO-4,5-DICHLORO-2-NITROBENZENE | 93361-94-5 | 2A-0108318 |
| 1-BROMO-4-(1,3-DIBROMOPROPYL)BENZENE | 58873-51-1 | 2A-0108324 |
| 1-BROMO-4-(2,2,2-TRIFLUOROETHOXY)BENZENE | 106854-77-7 | 2A-0108325 |
| 1-BROMO-4-(3-BROMO-1-CHLOROPROPYL)BENZENE | 33994-21-7 | 2A-0108327 |
| 1-BROMO-4-(BUTYLSULFONYL)BENZENE | 403793-28-2 | 2A-0108330 |
| 1-BROMO-4-(CYCLOPENTYLSULFONYL)BENZENE | 173387-45-6 | 2A-0108333 |
| 1-BROMO-4-(CYCLOPROPYLSULFONYL)BENZENE | 648906-28-9 | 2A-0108334 |
| 1-BROMO-4-(ETHYLSULFONYL)BENZENE | 26732-20-7 | 2A-0108338 |
| 1-BROMO-4-(ISOBUTYLSULFONYL)BENZENE | 856060-51-0 | 2A-0108339 |
| 1-BROMO-4-(ISOPROPYLSULFINYL)BENZENE | 363136-59-8 | 2A-0108340 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA