
CAS Number700-36-7
Synonyms2-Bromo-4-fluoro-1-nitro-benzene; 4-Fluor-2-brom-1-nitro-benzol; Benzene,2-bromo-4-fluoro-1-nitro; 3-bromo-1-fluoro-4-nitrobenzene; 2-Bromo-4-fluoronitrobenzene; WNR DF BE; 1-bromo-5-fluoro-2-nitrobenzene; MFCD00792441; 2-Bromo-4-fluoro-1-nitrobenzene; 4-fluoro-2-bromonitrobenzene
Molecular FormulaBrC6H3(F)NO2
Molecular Weight220.00
Purity96%
Density1.8±0.1 g/cm3
Boiling Point240-241 °C (lit.)
Melting Point18-19 °C (lit.)
AppearanceSolid | Pale yellow to green
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 700-36-7 |
| Catalog No. | 2A-9001077 |
| Chinese Name | 2-溴-4-氟-1-硝基苯 |
| Synonyms | 2-Bromo-4-fluoro-1-nitro-benzene; 4-Fluor-2-brom-1-nitro-benzol; Benzene,2-bromo-4-fluoro-1-nitro; 3-bromo-1-fluoro-4-nitrobenzene; 2-Bromo-4-fluoronitrobenzene; WNR DF BE; 1-bromo-5-fluoro-2-nitrobenzene; MFCD00792441; 2-Bromo-4-fluoro-1-nitrobenzene; 4-fluoro-2-bromonitrobenzene |
| Molecular Formula | BrC6H3(F)NO2 |
| Molecular Weight | 220.00 |
| Purity | 96 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 240-241 °C (lit.) |
| Melting Point | 18-19 °C (lit.) |
| Appearance | Solid | Pale yellow to green |
| Storage Condition | Room Temperature |
| HTC | 2904909090 |
| PubChem ID | 24878380 |
| MDL Number | MFCD00129165 |
| SMILES | [O-][N+](=O)c1cc(Br)ccc1F |
| InChI | 1S/C6H3BrFNO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| InChI Key | UQEANKGXXSENNF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/1077_1_700_36_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-Bromo-4-fluoro-1-nitrobenzene Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Bromo-4-fluoronaphthalene | 341-41-3 | 2A-9001072 |
| 1-Bromo-4-iodobenzene | 589-87-7 | 2A-9001073 |
| 1-Bromo-4-isobutylbenzene | 2051-99-2 | 2A-9001074 |
| 1-Bromo-5-(4-methoxyphenyl)pentane | 14469-84-2 | 2A-9001075 |
| 1-Bromo-5-chloro-3-fluoro-2-iodobenzene | 201849-16-3 | 2A-9001076 |
| 1-Bromo-5-phenylpentane | 14469-83-1 | 2A-9001078 |
| 1-Bromo-6,6-dimethyl-2-hepten-4-yne | 126764-15-6 | 2A-9001079 |
| 1-Bromo-8-phenyloctane | 54646-75-2 | 2A-9001081 |
| 1-Bromoadamantane | 768-90-1 | 2A-9001082 |
| 1-Bromononafluorobutane | 375-48-4 | 2A-9001085 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA