
CAS Number158062-67-0
SynonymsN-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide; IKI 220; N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide; N-(Cyanomethyl)-4-(trifluoromethyl)-3-pyridinecarboximidic acid; F 1785; UNII-9500W2Z53J; Aria; N-cyanomethyl-4-(trifluoromethyl)nicotinamide; flonicamid; N-(Cyanomethyl)-4-(trifluoromethyl)-3-pyridinecarboxamide
Molecular FormulaC9H6F3N3O
Molecular Weight229.16
Purity98%
Density1.4±0.1 g/cm3
Boiling Point381.4±52.0 °C at 760 mmHg
Melting Point157.5°
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 158062-67-0 |
| Catalog No. | 2A-9010529 |
| Chinese Name | 氟啶虫酰胺 |
| Synonyms | N-(Cyanomethyl)-4-(trifluoromethyl)nicotinamide; IKI 220; N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide; N-(Cyanomethyl)-4-(trifluoromethyl)-3-pyridinecarboximidic acid; F 1785; UNII-9500W2Z53J; Aria; N-cyanomethyl-4-(trifluoromethyl)nicotinamide; flonicamid; N-(Cyanomethyl)-4-(trifluoromethyl)-3-pyridinecarboxamide |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 381.4±52.0 °C at 760 mmHg |
| Melting Point | 157.5° |
| Appearance | solid |
| Water Solubility | Water solubility: Practically insoluble; water sol |
| Storage Condition | 0-10°C; store in inert gas; avoid air, heat |
| Application | Flonicamid (IKI220) is a new systemic insecticide (insecticide) that is selective against hemiparasitic pests. The primary insecticidal mechanism of Flonicamid is starvation through inhibition of styl |
| PubChem ID | 329754258 |
| MDL Number | MFCD07364026 |
| SMILES | FC(F)(F)c1ccncc1C(=O)NCC#N |
| InChI | 1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16) |
| InChI Key | RLQJEEJISHYWON-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/10529_1_158062_67_0.pdf |
| Transport Info | Product name: Flonicamid |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Fenoxaprop-P | 113158-40-0 | 2A-9010485 |
| Fenpropimorph | 67306-03-0 | 2A-9010492 |
| Fenpyroximate | 111812-58-9 | 2A-9010493 |
| Fenvalerate | 51630-58-1 | 2A-9010503 |
| Fipronil | 120068-37-3 | 2A-9010515 |
| Fluazifop-butyl | 69806-50-4 | 2A-9010537 |
| Flucythrinate | 70124-77-5 | 2A-9010546 |
| Fludioxonil | 131341-86-1 | 2A-9010549 |
| Flumioxazin | 103361-09-7 | 2A-9010560 |
| Fluoroglycofen-ethyl | 77501-90-7 | 2A-9010569 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA