
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14123-60-5 |
| Catalog No. | 2A-0105050 |
| Chinese Name | 1-(3-氯苯基)丙-2-酮 |
| Synonyms | 1-(3-Chlorophenyl)acetone; 1-(3-Chlorophenyl)propan-2-one; 1-(3-Chlorophenyl)-2-propanone |
| Molecular Formula | C9H9O1Cl1 |
| Molecular Weight | 168.62 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 236.5±15.0 °C at 760 mmHg |
| Appearance | Liquid | Clear yellow |
| Storage Condition | room temperature, airtight |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00082872 |
| SMILES | CC(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H9ClO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
| InChI Key | VCNYPJMEQHTAHS-UHFFFAOYSA-N |
| MSDS | msds/105050_1_14123_60_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(3-CHLOROPHENYL)-3-(1-METHYL-1H-PYRAZOL-3-YL)THIOUREA | 903692-67-1 | 2A-0105023 |
| 1-(3-CHLOROPHENYL)-3-(5-METHYLISOXAZOL-3-YL)UREA | 381698-55-1 | 2A-0105027 |
| 1-(3-CHLOROPHENYL)PIPERAZIN-2-ONE | 183500-70-1 | 2A-0105043 |
| 1-(3-CHLOROPHENYL)PIPERAZIN-2-ONE HYDROCHLORIDE | 183500-94-9 | 2A-0105044 |
| 1-(3-CHLOROPHENYL)PIPERIDIN-2-ONE | 132573-12-7 | 2A-0105048 |
| 1-(3-CHLOROPHENYL)PYRROLIDIN-2-ONE | 24051-35-2 | 2A-0105051 |
| 1-(3-CHLOROPROPYL)-1H-IMIDAZOL-2(3H)-ONE | 915922-15-5 | 2A-0105053 |
| 1-(3-CHLOROPYRAZIN-2-YL)ETHANONE | 121246-90-0 | 2A-0105062 |
| 1-(3-CHLOROPYRAZIN-2-YL)PYRROLIDIN-2-ONE | 720692-53-5 | 2A-0105063 |
| 1-(3-CYCLOPROPYL-1,2,4-OXADIAZOL-5-YL)-N-METHYLMETHANAMINE | 1036471-29-0 | 2A-0105078 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA