
CAS Number21906-32-1
Synonyms1-(3-Bromphenyl)propan-2-on; MFCD00210400; 3-Bromophenylacetone; 1-(3-Bromophenyl)propan-2-one; 1-(3-Bromphenyl)aceton; m-bromophenylpropan-2-one; 1-(3-Bromophenyl)acetone
Molecular FormulaC9H9O1Br1
Molecular Weight213.07
Purity96+%
Density1.4±0.1 g/cm3
Boiling Point265.7±15.0 °C at 760 mmHg
AppearanceTransparent light yellow liquid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21906-32-1 |
| Catalog No. | 2A-0104956 |
| Chinese Name | 3-溴苯丙酮 |
| Synonyms | 1-(3-Bromphenyl)propan-2-on; MFCD00210400; 3-Bromophenylacetone; 1-(3-Bromophenyl)propan-2-one; 1-(3-Bromphenyl)aceton; m-bromophenylpropan-2-one; 1-(3-Bromophenyl)acetone |
| Molecular Formula | C9H9O1Br1 |
| Molecular Weight | 213.07 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 265.7±15.0 °C at 760 mmHg |
| Appearance | Transparent light yellow liquid |
| Storage Condition | Sealed in a cool, dry environment |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00210400 |
| SMILES | CC(=O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C9H9BrO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
| InChI Key | FQIZFAJMBXZVOL-UHFFFAOYSA-N |
| MSDS | msds/104956_1_21906_32_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(3-BROMOPHENYL)-N-METHYLPIPERIDIN-4-AMINE | 1184235-17-3 | 2A-0104946 |
| 1-(3-BROMOPHENYL)CYCLOPROPANAMINE | 546115-65-5 | 2A-0104947 |
| 1-(3-BROMOPHENYL)CYCLOPROPANECARBONITRILE | 124276-83-1 | 2A-0104948 |
| 1-(3-BROMOPHENYL)IMIDAZOLIDIN-2-ONE | 14088-96-1 | 2A-0104951 |
| 1-(3-BROMOPHENYL)PIPERIDIN-4-AMINE | 1179833-02-3 | 2A-0104953 |
| 1-(3-BROMOPROPOXY)-4-(TERT-BUTYL)BENZENE | 3245-63-4 | 2A-0104958 |
| 1-(3-BROMOPROPOXY)-4-METHYLBENZENE | 16929-24-1 | 2A-0104959 |
| 1-(3-BROMOPROPYL)-2,2,5,5-TETRAMETHYL-1,2,5-AZADISILOLIDINE | 95091-93-3 | 2A-0104961 |
| 1-(3-BROMOPROPYL)-2-FLUOROBENZENE | 129254-75-7 | 2A-0104962 |
| 1-(3-BROMOPROPYL)-4-FLUOROBENZENE | 24484-55-7 | 2A-0104963 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA