
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 127413-59-6 |
| Catalog No. | 2A-0104938 |
| Chinese Name | 1-(3-溴-5-硝基苯基)乙酮 |
| Synonyms | 1-(3-Bromo-5-nitrophenyl)ethanone |
| Molecular Formula | C8H6FNO4 |
| Molecular Weight | 244.042 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 293.4±25.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| SMILES | FC(C=C(C=C1[N+]([O-])=O)C(C)=O)=C1O |
| InChI | 1S/C8H6FNO4/c1-4(11)5-2-6(9)8(12)7(3-5)10(13)14/h2-3,12H,1H3 |
| InChI Key | YPOXIOBHGOKAOE-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/104938_1_127413_59_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(3-AMINOPYRAZIN-2-YL)ETHANONE | 121246-93-3 | 2A-0104909 |
| 1-(3-BROMO-2-METHOXYPHENYL)-2-CHLOROETHANONE | 267651-24-1 | 2A-0104919 |
| 1-(3-BROMO-5-CHLOROPHENYL)ETHANONE | 154257-85-9 | 2A-0104927 |
| 1-(3-BROMO-5-FLUOROPHENYL)-2-METHYLPROPAN-1-ONE | 1147871-74-6 | 2A-0104930 |
| 1-(3-BROMO-5-FLUOROPHENYL)ETHANONE | 105515-20-6 | 2A-0104931 |
| 1-(3-BROMOPHENOXY)-2-FLUORO-4-NITROBENZENE | 74660-86-9 | 2A-0104940 |
| 1-(3-BROMOPHENYL)-2,2,2-TRIFLUOROETHANONE | 655-26-5 | 2A-0104942 |
| 1-(3-BROMOPHENYL)-N-METHYLPIPERIDIN-4-AMINE | 1184235-17-3 | 2A-0104946 |
| 1-(3-BROMOPHENYL)CYCLOPROPANAMINE | 546115-65-5 | 2A-0104947 |
| 1-(3-BROMOPHENYL)CYCLOPROPANECARBONITRILE | 124276-83-1 | 2A-0104948 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA