
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 67818-41-1 |
| Catalog No. | 2A-0104395 |
| Chinese Name | 2-氯-4-硝基苯基乙酮 |
| Synonyms | 1-(2-chloro-4-nitrophenyl)ethan-1-one; 1-(2-Chloro-4-nitrophenyl)ethanone |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 199.591 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 270.9±20.0 °C at 760 mmHg |
| Melting Point | 43.0 to 47.0 °C |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| MDL Number | MFCD03424514 |
| SMILES | [O-][N+](C1=C(O)C(C(C)=O)=CC(Cl)=C1C)=O |
| InChI | 1S/C9H8ClNO4/c1-4-7(10)3-6(5(2)12)9(13)8(4)11(14)15/h3,13H,1-2H3 |
| InChI Key | UQVHWGGRXQWGGY-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(2-BROMOPHENYL)CYCLOPROPANAMINE | 604799-96-4 | 2A-0104377 |
| 1-(2-CHLORO-1H-BENZO[D]IMIDAZOL-1-YL)ETHANONE | 90533-07-6 | 2A-0104387 |
| 1-(2-CHLORO-3-FLUOROPHENYL)ETHANONE | 161957-57-9 | 2A-0104388 |
| 1-(2-CHLORO-4-FLUOROBENZYL)-1H-PYRAZOL-4-AMINE HYDROCHLORIDE | 1147222-53-4 | 2A-0104390 |
| 1-(2-CHLORO-4-METHOXYPHENYL)ETHANONE | 41068-36-4 | 2A-0104393 |
| 1-(2-CHLOROACETYL)-1,3-DIHYDRO-2H-INDOL-2-ONE | 937606-68-3 | 2A-0104427 |
| 1-(2-CHLOROBENZYL)-1H-PYRAZOL-5-AMINE | 3524-28-5 | 2A-0104430 |
| 1-(2-CHLOROBENZYL)-4-METHYL-1H-PYRAZOL-5-AMINE | 1015845-68-7 | 2A-0104431 |
| 1-(2-CHLOROBENZYL)GUANIDINE | 4406-27-3 | 2A-0104433 |
| 1-(2-CHLOROETHYL)-1-(4-CYANOPHENYL)UREA | 13908-43-5 | 2A-0104443 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA