
CAS Number80844-07-1
SynonymsTREBON; mti500; MFCD00210287; 1-{[2-(4-Ethoxyphenyl)-2-methylpropoxy]methyl}-3-phenoxybenzene; 1-[[2-(4-ethoxyphenyl)-2-methylpropoxy]methyl]-3-phenoxybenzene; a-((p-ethoxy-b,b-dimethylphenethyl)oxy)-m-phenoxytoluene; Ethophenprox; PEPE; Etofenprox; NUKIL; Ethofenprox; PUNKASO; 1-((2-(4-Ethoxyphenyl)-2-methylpropoxy)methyl)-3-phenoxybenzene; EINECS 407-980-2; VECTRON; 2-(4-ethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether
Molecular FormulaC25H28O3
Molecular Weight376.49
Purity99%
Density1.1±0.1 g/cm3
Boiling Point481.6±40.0 °C at 760 mmHg
Melting Point36ºC
Appearancesolid
EINECS407-980-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80844-07-1 |
| Catalog No. | 2A-9010418 |
| Chinese Name | 依芬普司 |
| Synonyms | TREBON; mti500; MFCD00210287; 1-{[2-(4-Ethoxyphenyl)-2-methylpropoxy]methyl}-3-phenoxybenzene; 1-[[2-(4-ethoxyphenyl)-2-methylpropoxy]methyl]-3-phenoxybenzene; a-((p-ethoxy-b,b-dimethylphenethyl)oxy)-m-phenoxytoluene; Ethophenprox; PEPE; Etofenprox; NUKIL; Ethofenprox; PUNKASO; 1-((2-(4-Ethoxyphenyl)-2-methylpropoxy)methyl)-3-phenoxybenzene; EINECS 407-980-2; VECTRON; 2-(4-ethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.49 |
| Purity | 99 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 481.6±40.0 °C at 760 mmHg |
| Melting Point | 36ºC |
| Appearance | solid |
| Storage Condition | Warehouse ventilation and low temperature drying 0 |
| Application | Etofenopril is a non-ester pyrethroid insecticide. Etofenopril is toxic to house flies (LCD=23ng/fly). Formulations containing etofenpril have been used to control agricultural pests. |
| EINECS | 407-980-2 |
| PubChem ID | 329754810 |
| MDL Number | MFCD00210287 |
| SMILES | CCOc1ccc(cc1)C(C)(C)COCc2cccc(Oc3ccccc3)c2 |
| InChI | 1S/C25H28O3/c1-4-27-22-15-13-21(14-16-22)25(2,3)19-26-18-20-9-8-12-24(17-20)28-23-10-6-5-7-11-23/h5-17H,4,18-19H2,1-3H3 |
| InChI Key | YREQHYQNNWYQCJ-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/10418_1_80844_07_1.pdf |
| Transport Info | Product Name: Ethiomethrin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Etiracetam | 33996-58-6 | 2A-9010413 |
| Etiroxate | 17365-01-4 | 2A-9010414 |
| Etizolam | 40054-69-1 | 2A-0200212 |
| Etobenzanid | 79540-50-4 | 2A-9010416 |
| Etodolac | 41340-25-4 | 2A-9010417 |
| Etofibrate | 31637-97-5 | 2A-9010419 |
| Etofylline clofibrate | 54504-70-0 | 2A-9010420 |
| Etomidate | 33125-97-2 | 2A-9010421 |
| Etomoxir | 82258-36-4 | 2A-9010422 |
| Etonogestrel | 54048-10-1 | 2A-9010423 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA