
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13621-23-3 |
| Catalog No. | 2A-0104111 |
| Chinese Name | 1-(2,4-二甲基-5-硝基苯基)乙酮 |
| Synonyms | Exact Mass 193.07400; PSA 62.89000; LogP 2.93740; InChIKey HKWHXCZNPRLETD-UHFFFAOYSA-N |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.212 |
| Purity | 96+ |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| MDL Number | MFCD03086981 |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(C)cc1C |
| InChI Key | HKWHXCZNPRLETD-UHFFFAOYSA-N |
| MSDS | msds/104111_1_13621_23_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1-(2,4-DIFLUOROPHENYL)PYRROLIDINE | 1334499-91-0 | 2A-0104097 |
| 1-(2,4-DIHYDROXY-3-(TRIFLUOROMETHYL)PHENYL)-2-METHYLPROPAN-1-ONE | 1204737-93-8 | 2A-0104099 |
| 1-(2,4-DIHYDROXY-5-ISOPROPYLPHENYL)ETHANONE | 747414-17-1 | 2A-0104101 |
| 1-(2,4-DIHYDROXY-6-METHOXYPHENYL)-3-PHENYLPROP-2-EN-1-ONE | 18956-16-6 | 2A-0104102 |
| 1-(2,4-DIHYDROXYPHENYL)-2-(4-NITROPHENYL)ETHANONE | 15485-63-9 | 2A-0104103 |
| 1-(2,4-DIMETHYLPHENYL)-5-OXOPYRROLIDINE-3-CARBOXYLIC ACID | 133748-22-8 | 2A-0104112 |
| 1-(2,4-DINITROPHENYL)-2-(1-PHENYLETHYLIDENE)HYDRAZINE | 1677-87-8 | 2A-0104116 |
| 1-(3-(2,4-DICHLOROPHENYL)-5-METHYLISOXAZOL-4-YL)ETHANONE | 169814-56-6 | 2A-0104830 |
| 1-(3-(2,4-DICHLOROPHENYL)ISOXAZOL-5-YL)ETHANONE | 175277-34-6 | 2A-0104831 |
| 1-(3-BROMO-2,4-DIFLUOROPHENYL)ETHANONE | 1210824-63-7 | 2A-0104916 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA