![1-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-5-YL)-PIPERAZINE structure, CAS 98206-09-8](/structures/120000/104035_1_98206_09_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 98206-09-8 |
| Catalog No. | 2A-0104035 |
| Chinese Name | 盐酸依托拉嗪 |
| Synonyms | 1-(2,3-Dihydrobenzo[b][1,4]dioxin-5-yl)piperazine |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 |
| Purity | ≥98 (HPLC) |
| Density | 1.18g/cm3 |
| Boiling Point | 384.3ºC at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20°C, sealed, dry |
| Application | Eltoprazine (DU28853) hydrochloride is a 5-HT1A and 5-HT1B receptor agonist and a 5-HT2C receptor antagonist. |
| EINECS | 0 |
| HTC | 0 |
| UN(IATA) | 0 |
| PubChem ID | 329825943 |
| MDL Number | MFCD06245586 |
| SMILES | [H]Cl.C1(OCCO2)=C2C(N3CCNCC3)=CC=C1 |
| InChI | 1S/C12H16N2O2.ClH/c1-2-10(14-6-4-13-5-7-14)12-11(3-1)15-8-9-16-12;/h1-3,13H,4-9H2;1H |
| InChI Key | JFSOSUNPIXJCIX-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352202 |
| MSDS | msds/104035_1_98206_09_8.pdf |
| Transport Info | Product name: Eltoprazine hydrochloride |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(1-METHYL-1H-IMIDAZO[4,5-B]PYRIDIN-2-YL)ETHANONE | 87806-04-9 | 2A-0103899 |
| 1-(1H-PYRAZOL-4-YL)PIPERAZINE | 1249151-02-7 | 2A-0103992 |
| 1-(1H-PYRROLO[2,3-C]PYRIDIN-3-YL)ETHANONE | 67058-71-3 | 2A-0103999 |
| 1-(2,2,2-TRIFLUOROACETYL)PIPERIDINE-4-CARBOXYLIC ACID | 126501-70-0 | 2A-0104006 |
| 1-(2,2-DIETHOXYETHYL)-4-METHYL-1H-PYRAZOLE | 1005631-56-0 | 2A-0104010 |
| 1-(2,3-DIHYDROBENZOFURAN-6-YL)PROPAN-2-AMINE | 152623-93-3 | 2A-0104042 |
| 1-(2,3-DIMETHYLPHENYL)-1H-IMIDAZOLE-2-THIOL | 17452-16-3 | 2A-0104045 |
| 1-(2,5-DICHLORO-4-NITROPHENYL)-1H-PYRROLE | 175135-54-3 | 2A-0104121 |
| 1-(2,5-DICHLOROBENZYL)PIPERIDINE-3-CARBOXYLIC ACID | 896045-33-3 | 2A-0104136 |
| 1-(2,5-DICHLOROBENZYL)PIPERIDINE-4-CARBOXYLIC ACID | 901920-33-0 | 2A-0104137 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA