
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17051-01-3 |
| Catalog No. | 2A-0102916 |
| Chinese Name | 4,4'-二丁氧基氧化偶氮苯 |
| Synonyms | (4-butoxyphenyl)-(4-butoxyphenyl)imino-oxidoazanium |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.43200 |
| Purity | 96+ |
| Density | 1.06g/cm3 |
| Boiling Point | 485.8ºC at 760mmHg |
| Storage Condition | Store in a sealed, cool, dry and away from light |
| EINECS | 0 |
| HTC | 2927000090 |
| UN(IATA) | 0 |
| SMILES | CCCCOc1ccc(N=[N+]([O-])c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-3-5-15-24-19-11-7-17(8-12-19)21-22(23)18-9-13-20(14-10-18)25-16-6-4-2/h7-14H,3-6,15-16H2,1-2H3 |
| InChI Key | DWRXFZDFCLDVQG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-BENZIODOXOLE-1(3H)-CARBONITRILE | 172876-96-9 | 2A-0102904 |
| 1,2-BIS(2-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)PROPAN-2-YL)DIAZENE | 20858-12-2 | 2A-0102910 |
| 1,2-BIS(2-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)PROPAN-2-YL)DIAZENE DIHYDROCHLORIDE | 27776-21-2 | 2A-0102911 |
| 1,2-BIS(2-FLUOROPHENYL)ETHANE | 349-38-2 | 2A-0102912 |
| 1,2-BIS(4-(DIMETHYLAMINO)PHENYL)ETHANE-1,2-DIONE | 17078-27-2 | 2A-0102915 |
| 1,2-BIS(4-CHLOROPHENYL)ETHENE | 1657-56-3 | 2A-0102918 |
| 1,2-BIS(4-FLUOROPHENYL)ETHANE-1,2-DIONE | 579-39-5 | 2A-0102919 |
| 1,2-BIS(4-PYRIDYL)ACETYLENE | 73564-69-9 | 2A-0102920 |
| 1,2-BIS(5-BROMOPYRIDIN-2-YL)DISULFANE | 872273-36-4 | 2A-0102921 |
| 1,2-BIS(5-NITROPYRIDIN-2-YL)DISULFANE | 2127-10-8 | 2A-0102922 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA